C15H21IN2O2S — CID 68877206
N-(3-ethyl-2-methyl-1,3-benzothiazol-3-ium-5-yl)-N-(2-methoxyethyl)acetamide iodide (PubChem CID 68877206) has the molecular formula C15H21IN2O2S and a molecular weight of 420.32 g/mol. Its IUPAC name is N-(3-ethyl-2-methyl-1,3-benzothiazol-3-ium-5-yl)-N-(2-methoxyethyl)acetamide iodide.
| Compound Name | N-(3-ethyl-2-methyl-1,3-benzothiazol-3-ium-5-yl)-N-(2-methoxyethyl)acetamide iodide |
|---|---|
| PubChem CID | 68877206 |
| Molecular Formula | C15H21IN2O2S |
| Molecular Weight | 420.32 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | N-(3-ethyl-2-methyl-1,3-benzothiazol-3-ium-5-yl)-N-(2-methoxyethyl)acetamide iodide |
| SMILES | CC[n+]1c(C)sc2ccc(N(CCOC)C(C)=O)cc21.[I-] |
| InChI | InChI=1S/C15H21N2O2S.HI/c1-5-16-12(3)20-15-7-6-13(10-14(15)16)17(11(2)18)8-9-19-4;/h6-7,10H,5,8-9H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | SKWSPXFYMACMKJ-UHFFFAOYSA-M |
| XLogP | -0.48 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.32 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|