C17H22N4O6 — CID 68877790
ethyl 3-[4-amino-7-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]prop-2-enoate (PubChem CID 68877790) has the molecular formula C17H22N4O6 and a molecular weight of 378.39 g/mol. Its IUPAC name is ethyl 3-[4-amino-7-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]prop-2-enoate.
| Compound Name | ethyl 3-[4-amino-7-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 68877790 |
| Molecular Formula | C17H22N4O6 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | ethyl 3-[4-amino-7-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2OC)c2ncnc(N)c12 |
| InChI | InChI=1S/C17H22N4O6/c1-3-26-11(23)5-4-9-6-21(16-12(9)15(18)19-8-20-16)17-14(25-2)13(24)10(7-22)27-17/h4-6,8,10,13-14,17,22,24H,3,7H2,1-2H3,(H2,18,19,20)/t10-,13-,14-,17-/m1/s1 |
| InChIKey | XVMMCBRWDMNRBK-IWCJZZDYSA-N |
| XLogP | -0.14 |
| TPSA | 141.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|