C11H12FIN2O — CID 68880844
(6-fluoro-3-pyridinyl)-(2-iodopiperidin-1-yl)methanone (PubChem CID 68880844) has the molecular formula C11H12FIN2O and a molecular weight of 334.13 g/mol. Its IUPAC name is (6-fluoro-3-pyridinyl)-(2-iodopiperidin-1-yl)methanone.
| Compound Name | (6-fluoro-3-pyridinyl)-(2-iodopiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 68880844 |
| Molecular Formula | C11H12FIN2O |
| Molecular Weight | 334.13 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | (6-fluoro-3-pyridinyl)-(2-iodopiperidin-1-yl)methanone |
| SMILES | O=C(c1ccc(F)nc1)N1CCCCC1I |
| InChI | InChI=1S/C11H12FIN2O/c12-9-5-4-8(7-14-9)11(16)15-6-2-1-3-10(15)13/h4-5,7,10H,1-3,6H2 |
| InChIKey | NZMJNCCZSDTBMP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.13 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|