C29H34ClN5O5 — CID 68881927
N-[5-chloro-7-(4-methoxybut-1-ynyl)-1,3-benzodioxol-4-yl]-6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-amine (PubChem CID 68881927) has the molecular formula C29H34ClN5O5 and a molecular weight of 568.07 g/mol. Its IUPAC name is N-[5-chloro-7-(4-methoxybut-1-ynyl)-1,3-benzodioxol-4-yl]-6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-amine.
| Compound Name | N-[5-chloro-7-(4-methoxybut-1-ynyl)-1,3-benzodioxol-4-yl]-6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-amine |
|---|---|
| PubChem CID | 68881927 |
| Molecular Formula | C29H34ClN5O5 |
| Molecular Weight | 568.07 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | N-[5-chloro-7-(4-methoxybut-1-ynyl)-1,3-benzodioxol-4-yl]-6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-amine |
| SMILES | COCCC#Cc1cc(Cl)c(Nc2ncnc3cc(OCCCN4CCN(C)CC4)c(OC)cc23)c2c1OCO2 |
| InChI | InChI=1S/C29H34ClN5O5/c1-34-9-11-35(12-10-34)8-6-14-38-25-17-23-21(16-24(25)37-3)29(32-18-31-23)33-26-22(30)15-20(7-4-5-13-36-2)27-28(26)40-19-39-27/h15-18H,5-6,8-14,19H2,1-3H3,(H,31,32,33) |
| InChIKey | HFQIDELENXMIAS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 90.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.07 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|