C10H9N3O4S — CID 68884349
2-(3-aminothiophen-2-yl)-5-hydroxy-1-methyl-6-oxopyrimidine-4-carboxylic acid (PubChem CID 68884349) has the molecular formula C10H9N3O4S and a molecular weight of 267.27 g/mol. Its IUPAC name is 2-(3-aminothiophen-2-yl)-5-hydroxy-1-methyl-6-oxopyrimidine-4-carboxylic acid.
| Compound Name | 2-(3-aminothiophen-2-yl)-5-hydroxy-1-methyl-6-oxopyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 68884349 |
| Molecular Formula | C10H9N3O4S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 2-(3-aminothiophen-2-yl)-5-hydroxy-1-methyl-6-oxopyrimidine-4-carboxylic acid |
| SMILES | Cn1c(-c2sccc2N)nc(C(=O)O)c(O)c1=O |
| InChI | InChI=1S/C10H9N3O4S/c1-13-8(7-4(11)2-3-18-7)12-5(10(16)17)6(14)9(13)15/h2-3,14H,11H2,1H3,(H,16,17) |
| InChIKey | UDSURMOFZZNDNI-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |