C9H6N2O4S — CID 135433415
5-hydroxy-6-oxo-2-thiophen-2-yl-1H-pyrimidine-4-carboxylic acid (PubChem CID 135433415) has the molecular formula C9H6N2O4S and a molecular weight of 238.22 g/mol. Its IUPAC name is 5-hydroxy-6-oxo-2-thiophen-2-yl-1H-pyrimidine-4-carboxylic acid.
| Compound Name | 5-hydroxy-6-oxo-2-thiophen-2-yl-1H-pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 135433415 |
| Molecular Formula | C9H6N2O4S |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | 5-hydroxy-6-oxo-2-thiophen-2-yl-1H-pyrimidine-4-carboxylic acid |
| SMILES | O=C(O)c1nc(-c2cccs2)[nH]c(=O)c1O |
| InChI | InChI=1S/C9H6N2O4S/c12-6-5(9(14)15)10-7(11-8(6)13)4-2-1-3-16-4/h1-3,12H,(H,14,15)(H,10,11,13) |
| InChIKey | SSOGKSFNCMYOPA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |