C9H7N3O3S — CID 135446332
5-hydroxy-6-oxo-2-thiophen-2-yl-1H-pyrimidine-4-carboxamide (PubChem CID 135446332) has the molecular formula C9H7N3O3S and a molecular weight of 237.24 g/mol. Its IUPAC name is 5-hydroxy-6-oxo-2-thiophen-2-yl-1H-pyrimidine-4-carboxamide.
| Compound Name | 5-hydroxy-6-oxo-2-thiophen-2-yl-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 135446332 |
| Molecular Formula | C9H7N3O3S |
| Molecular Weight | 237.24 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 5-hydroxy-6-oxo-2-thiophen-2-yl-1H-pyrimidine-4-carboxamide |
| SMILES | NC(=O)c1nc(-c2cccs2)[nH]c(=O)c1O |
| InChI | InChI=1S/C9H7N3O3S/c10-7(14)5-6(13)9(15)12-8(11-5)4-2-1-3-16-4/h1-3,13H,(H2,10,14)(H,11,12,15) |
| InChIKey | SCXAUENZKSNKQP-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 109.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |