C14H11N3O3S2 — CID 135971583
5-hydroxy-6-oxo-2-thiophen-2-yl-N-(thiophen-2-ylmethyl)-1H-pyrimidine-4-carboxamide (PubChem CID 135971583) has the molecular formula C14H11N3O3S2 and a molecular weight of 333.39 g/mol. Its IUPAC name is 5-hydroxy-6-oxo-2-thiophen-2-yl-N-(thiophen-2-ylmethyl)-1H-pyrimidine-4-carboxamide.
| Compound Name | 5-hydroxy-6-oxo-2-thiophen-2-yl-N-(thiophen-2-ylmethyl)-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 135971583 |
| Molecular Formula | C14H11N3O3S2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 5-hydroxy-6-oxo-2-thiophen-2-yl-N-(thiophen-2-ylmethyl)-1H-pyrimidine-4-carboxamide |
| SMILES | O=C(NCc1cccs1)c1nc(-c2cccs2)[nH]c(=O)c1O |
| InChI | InChI=1S/C14H11N3O3S2/c18-11-10(13(19)15-7-8-3-1-5-21-8)16-12(17-14(11)20)9-4-2-6-22-9/h1-6,18H,7H2,(H,15,19)(H,16,17,20) |
| InChIKey | IQVWIKWYURRSAA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |