C27H33ClFN3O2 — CID 68885781
2-[2-(4-chloro-3-fluorophenyl)-5-methoxy-1,3-dihydrobenzimidazol-2-yl]-2-cyclohexyl-N-cyclopentylacetamide (PubChem CID 68885781) has the molecular formula C27H33ClFN3O2 and a molecular weight of 486.03 g/mol. Its IUPAC name is 2-[2-(4-chloro-3-fluorophenyl)-5-methoxy-1,3-dihydrobenzimidazol-2-yl]-2-cyclohexyl-N-cyclopentylacetamide.
| Compound Name | 2-[2-(4-chloro-3-fluorophenyl)-5-methoxy-1,3-dihydrobenzimidazol-2-yl]-2-cyclohexyl-N-cyclopentylacetamide |
|---|---|
| PubChem CID | 68885781 |
| Molecular Formula | C27H33ClFN3O2 |
| Molecular Weight | 486.03 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 2-[2-(4-chloro-3-fluorophenyl)-5-methoxy-1,3-dihydrobenzimidazol-2-yl]-2-cyclohexyl-N-cyclopentylacetamide |
| SMILES | COc1ccc2c(c1)NC(c1ccc(Cl)c(F)c1)(C(C(=O)NC1CCCC1)C1CCCCC1)N2 |
| InChI | InChI=1S/C27H33ClFN3O2/c1-34-20-12-14-23-24(16-20)32-27(31-23,18-11-13-21(28)22(29)15-18)25(17-7-3-2-4-8-17)26(33)30-19-9-5-6-10-19/h11-17,19,25,31-32H,2-10H2,1H3,(H,30,33) |
| InChIKey | RMYQOBRLOQMVNJ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.03 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|