C26H34ClN3O2S — CID 68887165
2-[2-(5-chlorothiophen-2-yl)-5-methoxy-1,3-dihydrobenzimidazol-2-yl]-N,2-dicyclohexylacetamide (PubChem CID 68887165) has the molecular formula C26H34ClN3O2S and a molecular weight of 488.10 g/mol. Its IUPAC name is 2-[2-(5-chlorothiophen-2-yl)-5-methoxy-1,3-dihydrobenzimidazol-2-yl]-N,2-dicyclohexylacetamide.
| Compound Name | 2-[2-(5-chlorothiophen-2-yl)-5-methoxy-1,3-dihydrobenzimidazol-2-yl]-N,2-dicyclohexylacetamide |
|---|---|
| PubChem CID | 68887165 |
| Molecular Formula | C26H34ClN3O2S |
| Molecular Weight | 488.10 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | 2-[2-(5-chlorothiophen-2-yl)-5-methoxy-1,3-dihydrobenzimidazol-2-yl]-N,2-dicyclohexylacetamide |
| SMILES | COc1ccc2c(c1)NC(c1ccc(Cl)s1)(C(C(=O)NC1CCCCC1)C1CCCCC1)N2 |
| InChI | InChI=1S/C26H34ClN3O2S/c1-32-19-12-13-20-21(16-19)30-26(29-20,22-14-15-23(27)33-22)24(17-8-4-2-5-9-17)25(31)28-18-10-6-3-7-11-18/h12-18,24,29-30H,2-11H2,1H3,(H,28,31) |
| InChIKey | JUJMEJMYFHEITD-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.10 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|