C25H34N4O — CID 68886192
2-[2-(4-aminophenyl)-1,3-dihydrobenzimidazol-2-yl]-N-cyclohexyl-4-methylpentanamide (PubChem CID 68886192) has the molecular formula C25H34N4O and a molecular weight of 406.57 g/mol. Its IUPAC name is 2-[2-(4-aminophenyl)-1,3-dihydrobenzimidazol-2-yl]-N-cyclohexyl-4-methylpentanamide.
| Compound Name | 2-[2-(4-aminophenyl)-1,3-dihydrobenzimidazol-2-yl]-N-cyclohexyl-4-methylpentanamide |
|---|---|
| PubChem CID | 68886192 |
| Molecular Formula | C25H34N4O |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 2-[2-(4-aminophenyl)-1,3-dihydrobenzimidazol-2-yl]-N-cyclohexyl-4-methylpentanamide |
| SMILES | CC(C)CC(C(=O)NC1CCCCC1)C1(c2ccc(N)cc2)Nc2ccccc2N1 |
| InChI | InChI=1S/C25H34N4O/c1-17(2)16-21(24(30)27-20-8-4-3-5-9-20)25(18-12-14-19(26)15-13-18)28-22-10-6-7-11-23(22)29-25/h6-7,10-15,17,20-21,28-29H,3-5,8-9,16,26H2,1-2H3,(H,27,30) |
| InChIKey | WTAHCUGLCAMSKZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|