C20H13ClO2S — CID 68886590
4-(17-chloro-13-oxa-3-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaen-4-yl)but-3-en-2-one (PubChem CID 68886590) has the molecular formula C20H13ClO2S and a molecular weight of 352.84 g/mol. Its IUPAC name is 4-(17-chloro-13-oxa-3-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaen-4-yl)but-3-en-2-one.
| Compound Name | 4-(17-chloro-13-oxa-3-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaen-4-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 68886590 |
| Molecular Formula | C20H13ClO2S |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 4-(17-chloro-13-oxa-3-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaen-4-yl)but-3-en-2-one |
| SMILES | CC(=O)C=Cc1cc2c(s1)-c1cc(Cl)ccc1Oc1ccccc1-2 |
| InChI | InChI=1S/C20H13ClO2S/c1-12(22)6-8-14-11-16-15-4-2-3-5-18(15)23-19-9-7-13(21)10-17(19)20(16)24-14/h2-11H,1H3 |
| InChIKey | HROMICXIICYESN-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|