C27H28N4O6S2 — CID 68888371
N-[1-[4-(1-oxidopyridin-1-ium-3-yl)sulfonyl-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-1-oxopentan-2-yl]-4-thiophen-2-ylbenzamide (PubChem CID 68888371) has the molecular formula C27H28N4O6S2 and a molecular weight of 568.68 g/mol. Its IUPAC name is N-[1-[4-(1-oxidopyridin-1-ium-3-yl)sulfonyl-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-1-oxopentan-2-yl]-4-thiophen-2-ylbenzamide.
| Compound Name | N-[1-[4-(1-oxidopyridin-1-ium-3-yl)sulfonyl-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-1-oxopentan-2-yl]-4-thiophen-2-ylbenzamide |
|---|---|
| PubChem CID | 68888371 |
| Molecular Formula | C27H28N4O6S2 |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.15 |
| IUPAC Name | N-[1-[4-(1-oxidopyridin-1-ium-3-yl)sulfonyl-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-1-oxopentan-2-yl]-4-thiophen-2-ylbenzamide |
| SMILES | CCCC(NC(=O)c1ccc(-c2cccs2)cc1)C(=O)N1CCC2C1C(=O)CN2S(=O)(=O)c1ccc[n+]([O-])c1 |
| InChI | InChI=1S/C27H28N4O6S2/c1-2-5-21(28-26(33)19-10-8-18(9-11-19)24-7-4-15-38-24)27(34)30-14-12-22-25(30)23(32)17-31(22)39(36,37)20-6-3-13-29(35)16-20/h3-4,6-11,13,15-16,21-22,25H,2,5,12,14,17H2,1H3,(H,28,33) |
| InChIKey | HIWXITGDBUHOND-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|