C24H26N4O6S3 — CID 91593544
N-[4-methyl-1-[4-(1-oxidopyridin-1-ium-3-yl)sulfonyl-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-1-oxopentan-2-yl]thieno[3,2-b]thiophene-5-carboxamide (PubChem CID 91593544) has the molecular formula C24H26N4O6S3 and a molecular weight of 562.70 g/mol. Its IUPAC name is N-[4-methyl-1-[4-(1-oxidopyridin-1-ium-3-yl)sulfonyl-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-1-oxopentan-2-yl]thieno[3,2-b]thiophene-5-carboxamide.
| Compound Name | N-[4-methyl-1-[4-(1-oxidopyridin-1-ium-3-yl)sulfonyl-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-1-oxopentan-2-yl]thieno[3,2-b]thiophene-5-carboxamide |
|---|---|
| PubChem CID | 91593544 |
| Molecular Formula | C24H26N4O6S3 |
| Molecular Weight | 562.70 g/mol |
| Exact Mass | 562.10 |
| IUPAC Name | N-[4-methyl-1-[4-(1-oxidopyridin-1-ium-3-yl)sulfonyl-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-1-oxopentan-2-yl]thieno[3,2-b]thiophene-5-carboxamide |
| SMILES | CC(C)CC(NC(=O)c1cc2sccc2s1)C(=O)N1CCC2C1C(=O)CN2S(=O)(=O)c1ccc[n+]([O-])c1 |
| InChI | InChI=1S/C24H26N4O6S3/c1-14(2)10-16(25-23(30)21-11-20-19(36-21)6-9-35-20)24(31)27-8-5-17-22(27)18(29)13-28(17)37(33,34)15-4-3-7-26(32)12-15/h3-4,6-7,9,11-12,14,16-17,22H,5,8,10,13H2,1-2H3,(H,25,30) |
| InChIKey | UNXPIKOYABFYQM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.70 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|