C27H33F2N3O3 — CID 68895289
1-[(5R)-3-(2,5-difluorophenyl)-5-[3-(3,3-dimethoxypiperidin-1-yl)propyl]-5-phenyl-4H-pyrazol-1-yl]ethanone (PubChem CID 68895289) has the molecular formula C27H33F2N3O3 and a molecular weight of 485.58 g/mol. Its IUPAC name is 1-[(5R)-3-(2,5-difluorophenyl)-5-[3-(3,3-dimethoxypiperidin-1-yl)propyl]-5-phenyl-4H-pyrazol-1-yl]ethanone.
| Compound Name | 1-[(5R)-3-(2,5-difluorophenyl)-5-[3-(3,3-dimethoxypiperidin-1-yl)propyl]-5-phenyl-4H-pyrazol-1-yl]ethanone |
|---|---|
| PubChem CID | 68895289 |
| Molecular Formula | C27H33F2N3O3 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | 1-[(5R)-3-(2,5-difluorophenyl)-5-[3-(3,3-dimethoxypiperidin-1-yl)propyl]-5-phenyl-4H-pyrazol-1-yl]ethanone |
| SMILES | COC1(OC)CCCN(CCC[C@]2(c3ccccc3)CC(c3cc(F)ccc3F)=NN2C(C)=O)C1 |
| InChI | InChI=1S/C27H33F2N3O3/c1-20(33)32-26(21-9-5-4-6-10-21,18-25(30-32)23-17-22(28)11-12-24(23)29)13-7-15-31-16-8-14-27(19-31,34-2)35-3/h4-6,9-12,17H,7-8,13-16,18-19H2,1-3H3/t26-/m1/s1 |
| InChIKey | ASCDIAQVZRMZSQ-AREMUKBSSA-N |
| XLogP | 4.68 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|