C20H22FN2O5P — CID 11640360
2-[(3R)-2-acetyl-5-(2-fluoro-5-methylphenyl)-3-phenyl-4H-pyrazol-3-yl]ethyl dihydrogen phosphate (PubChem CID 11640360) has the molecular formula C20H22FN2O5P and a molecular weight of 420.38 g/mol. Its IUPAC name is 2-[(3R)-2-acetyl-5-(2-fluoro-5-methylphenyl)-3-phenyl-4H-pyrazol-3-yl]ethyl dihydrogen phosphate.
| Compound Name | 2-[(3R)-2-acetyl-5-(2-fluoro-5-methylphenyl)-3-phenyl-4H-pyrazol-3-yl]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 11640360 |
| Molecular Formula | C20H22FN2O5P |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 2-[(3R)-2-acetyl-5-(2-fluoro-5-methylphenyl)-3-phenyl-4H-pyrazol-3-yl]ethyl dihydrogen phosphate |
| SMILES | CC(=O)N1N=C(c2cc(C)ccc2F)C[C@@]1(CCOP(=O)(O)O)c1ccccc1 |
| InChI | InChI=1S/C20H22FN2O5P/c1-14-8-9-18(21)17(12-14)19-13-20(23(22-19)15(2)24,10-11-28-29(25,26)27)16-6-4-3-5-7-16/h3-9,12H,10-11,13H2,1-2H3,(H2,25,26,27)/t20-/m0/s1 |
| InChIKey | MZFRZSHJZNLSAB-FQEVSTJZSA-N |
| XLogP | 3.49 |
| TPSA | 99.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|