C13H32N2OSi2 — CID 68896668
methoxy-dimethyl-[3-(4-trimethylsilylpiperazin-1-yl)propyl]silane (PubChem CID 68896668) has the molecular formula C13H32N2OSi2 and a molecular weight of 288.58 g/mol. Its IUPAC name is methoxy-dimethyl-[3-(4-trimethylsilylpiperazin-1-yl)propyl]silane.
| Compound Name | methoxy-dimethyl-[3-(4-trimethylsilylpiperazin-1-yl)propyl]silane |
|---|---|
| PubChem CID | 68896668 |
| Molecular Formula | C13H32N2OSi2 |
| Molecular Weight | 288.58 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | methoxy-dimethyl-[3-(4-trimethylsilylpiperazin-1-yl)propyl]silane |
| SMILES | CO[Si](C)(C)CCCN1CCN([Si](C)(C)C)CC1 |
| InChI | InChI=1S/C13H32N2OSi2/c1-16-18(5,6)13-7-8-14-9-11-15(12-10-14)17(2,3)4/h7-13H2,1-6H3 |
| InChIKey | BJHRUYZTRCZXLK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.58 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|