About dibutyl hydrogen phosphite;phenylmethanamine;propan-2-one
dibutyl hydrogen phosphite;phenylmethanamine;propan-2-one (PubChem CID 68898928) has the molecular formula C18H34NO4P
and a molecular weight of 359.45 g/mol. Its IUPAC name is dibutyl hydrogen phosphite;phenylmethanamine;propan-2-one.
Molecular Properties
| Compound Name | dibutyl hydrogen phosphite;phenylmethanamine;propan-2-one |
| PubChem CID | 68898928 |
| Molecular Formula | C18H34NO4P |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | dibutyl hydrogen phosphite;phenylmethanamine;propan-2-one |
| SMILES | CC(C)=O.CCCCOP(O)OCCCC.NCc1ccccc1 |
| InChI | InChI=1S/C8H19O3P.C7H9N.C3H6O/c1-3-5-7-10-12(9)11-8-6-4-2;8-6-7-4-2-1-3-5-7;1-3(2)4/h9H,3-8H2,1-2H3;1-5H,6,8H2;1-2H3 |
| InChIKey | ZYNRSVDMGQNNPB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dibutyl hydrogen phosphite;phenylmethanamine;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyl hydrogen phosphite;phenylmethanamine;propan-2-one?
The IUPAC name of dibutyl hydrogen phosphite;phenylmethanamine;propan-2-one (CID 68898928) is dibutyl hydrogen phosphite;phenylmethanamine;propan-2-one.
What is the SMILES notation for dibutyl hydrogen phosphite;phenylmethanamine;propan-2-one?
The canonical SMILES for dibutyl hydrogen phosphite;phenylmethanamine;propan-2-one is CC(C)=O.CCCCOP(O)OCCCC.NCc1ccccc1.
What is the InChIKey of dibutyl hydrogen phosphite;phenylmethanamine;propan-2-one?
The InChIKey is ZYNRSVDMGQNNPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19O3P.C7H9N.C3H6O/c1-3-5-7-10-12(9)11-8-6-4-2;8-6-7-4-2-1-3-5-7;1-3(2)4/h9H,3-8H2,1-2H3;1-5H,6,8H2;1-2H3.
What are the key properties of dibutyl hydrogen phosphite;phenylmethanamine;propan-2-one?
dibutyl hydrogen phosphite;phenylmethanamine;propan-2-one has a molecular weight of 359.45 g/mol, XLogP of 4.58, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyl hydrogen phosphite;phenylmethanamine;propan-2-one is sourced from PubChem (CID 68898928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).