About phenylmethanamine;trioctylphosphane
phenylmethanamine;trioctylphosphane (PubChem CID 174278232) has the molecular formula C31H60NP
and a molecular weight of 477.80 g/mol. Its IUPAC name is phenylmethanamine;trioctylphosphane.
Molecular Properties
| Compound Name | phenylmethanamine;trioctylphosphane |
| PubChem CID | 174278232 |
| Molecular Formula | C31H60NP |
| Molecular Weight | 477.80 g/mol |
| Exact Mass | 477.45 |
| IUPAC Name | phenylmethanamine;trioctylphosphane |
| SMILES | CCCCCCCCP(CCCCCCCC)CCCCCCCC.NCc1ccccc1 |
| InChI | InChI=1S/C24H51P.C7H9N/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;8-6-7-4-2-1-3-5-7/h4-24H2,1-3H3;1-5H,6,8H2 |
| InChIKey | UBTCGENEEKSZKL-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.80 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phenylmethanamine;trioctylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylmethanamine;trioctylphosphane?
The IUPAC name of phenylmethanamine;trioctylphosphane (CID 174278232) is phenylmethanamine;trioctylphosphane.
What is the SMILES notation for phenylmethanamine;trioctylphosphane?
The canonical SMILES for phenylmethanamine;trioctylphosphane is CCCCCCCCP(CCCCCCCC)CCCCCCCC.NCc1ccccc1.
What is the InChIKey of phenylmethanamine;trioctylphosphane?
The InChIKey is UBTCGENEEKSZKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H51P.C7H9N/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;8-6-7-4-2-1-3-5-7/h4-24H2,1-3H3;1-5H,6,8H2.
What are the key properties of phenylmethanamine;trioctylphosphane?
phenylmethanamine;trioctylphosphane has a molecular weight of 477.80 g/mol, XLogP of 10.70, 22 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenylmethanamine;trioctylphosphane is sourced from PubChem (CID 174278232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).