About octan-2-amine;phenylmethanamine
octan-2-amine;phenylmethanamine (PubChem CID 67561022) has the molecular formula C15H28N2
and a molecular weight of 236.40 g/mol. Its IUPAC name is octan-2-amine;phenylmethanamine.
Molecular Properties
| Compound Name | octan-2-amine;phenylmethanamine |
| PubChem CID | 67561022 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | octan-2-amine;phenylmethanamine |
| SMILES | CCCCCCC(C)N.NCc1ccccc1 |
| InChI | InChI=1S/C8H19N.C7H9N/c1-3-4-5-6-7-8(2)9;8-6-7-4-2-1-3-5-7/h8H,3-7,9H2,1-2H3;1-5H,6,8H2 |
| InChIKey | TYNLZOYMPBBJEN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octan-2-amine;phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octan-2-amine;phenylmethanamine?
The IUPAC name of octan-2-amine;phenylmethanamine (CID 67561022) is octan-2-amine;phenylmethanamine.
What is the SMILES notation for octan-2-amine;phenylmethanamine?
The canonical SMILES for octan-2-amine;phenylmethanamine is CCCCCCC(C)N.NCc1ccccc1.
What is the InChIKey of octan-2-amine;phenylmethanamine?
The InChIKey is TYNLZOYMPBBJEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.C7H9N/c1-3-4-5-6-7-8(2)9;8-6-7-4-2-1-3-5-7/h8H,3-7,9H2,1-2H3;1-5H,6,8H2.
What are the key properties of octan-2-amine;phenylmethanamine?
octan-2-amine;phenylmethanamine has a molecular weight of 236.40 g/mol, XLogP of 3.45, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octan-2-amine;phenylmethanamine is sourced from PubChem (CID 67561022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).