C26H27ClN2O5S — CID 68899097
2-(3-chloro-N-[3-(3-phenylpropanoylamino)phenyl]sulfonylanilino)-3-methylbutanoic acid (PubChem CID 68899097) has the molecular formula C26H27ClN2O5S and a molecular weight of 515.03 g/mol. Its IUPAC name is 2-(3-chloro-N-[3-(3-phenylpropanoylamino)phenyl]sulfonylanilino)-3-methylbutanoic acid.
| Compound Name | 2-(3-chloro-N-[3-(3-phenylpropanoylamino)phenyl]sulfonylanilino)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 68899097 |
| Molecular Formula | C26H27ClN2O5S |
| Molecular Weight | 515.03 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 2-(3-chloro-N-[3-(3-phenylpropanoylamino)phenyl]sulfonylanilino)-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)N(c1cccc(Cl)c1)S(=O)(=O)c1cccc(NC(=O)CCc2ccccc2)c1 |
| InChI | InChI=1S/C26H27ClN2O5S/c1-18(2)25(26(31)32)29(22-12-6-10-20(27)16-22)35(33,34)23-13-7-11-21(17-23)28-24(30)15-14-19-8-4-3-5-9-19/h3-13,16-18,25H,14-15H2,1-2H3,(H,28,30)(H,31,32) |
| InChIKey | VYGLOQHATKYYPM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.03 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |