About (4-fluorophenyl) 1-methyl-5-nitro-2-oxopyridine-3-carboxylate
(4-fluorophenyl) 1-methyl-5-nitro-2-oxopyridine-3-carboxylate (PubChem CID 68899411) has the molecular formula C13H9FN2O5
and a molecular weight of 292.22 g/mol. Its IUPAC name is (4-fluorophenyl) 1-methyl-5-nitro-2-oxopyridine-3-carboxylate.
Molecular Properties
| Compound Name | (4-fluorophenyl) 1-methyl-5-nitro-2-oxopyridine-3-carboxylate |
| PubChem CID | 68899411 |
| Molecular Formula | C13H9FN2O5 |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | (4-fluorophenyl) 1-methyl-5-nitro-2-oxopyridine-3-carboxylate |
| SMILES | Cn1cc([N+](=O)[O-])cc(C(=O)Oc2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C13H9FN2O5/c1-15-7-9(16(19)20)6-11(12(15)17)13(18)21-10-4-2-8(14)3-5-10/h2-7H,1H3 |
| InChIKey | AMEGHABYWKCKEP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 91.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-fluorophenyl) 1-methyl-5-nitro-2-oxopyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl) 1-methyl-5-nitro-2-oxopyridine-3-carboxylate?
The IUPAC name of (4-fluorophenyl) 1-methyl-5-nitro-2-oxopyridine-3-carboxylate (CID 68899411) is (4-fluorophenyl) 1-methyl-5-nitro-2-oxopyridine-3-carboxylate.
What is the SMILES notation for (4-fluorophenyl) 1-methyl-5-nitro-2-oxopyridine-3-carboxylate?
The canonical SMILES for (4-fluorophenyl) 1-methyl-5-nitro-2-oxopyridine-3-carboxylate is Cn1cc([N+](=O)[O-])cc(C(=O)Oc2ccc(F)cc2)c1=O.
What is the InChIKey of (4-fluorophenyl) 1-methyl-5-nitro-2-oxopyridine-3-carboxylate?
The InChIKey is AMEGHABYWKCKEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9FN2O5/c1-15-7-9(16(19)20)6-11(12(15)17)13(18)21-10-4-2-8(14)3-5-10/h2-7H,1H3.
What are the key properties of (4-fluorophenyl) 1-methyl-5-nitro-2-oxopyridine-3-carboxylate?
(4-fluorophenyl) 1-methyl-5-nitro-2-oxopyridine-3-carboxylate has a molecular weight of 292.22 g/mol, XLogP of 1.65, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl) 1-methyl-5-nitro-2-oxopyridine-3-carboxylate is sourced from PubChem (CID 68899411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).