C14H21NO3 — CID 68901550
[(2R)-2-benzyl-1-hydroxy-3,3-dimethylbutan-2-yl]carbamic acid (PubChem CID 68901550) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is [(2R)-2-benzyl-1-hydroxy-3,3-dimethylbutan-2-yl]carbamic acid.
| Compound Name | [(2R)-2-benzyl-1-hydroxy-3,3-dimethylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 68901550 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | [(2R)-2-benzyl-1-hydroxy-3,3-dimethylbutan-2-yl]carbamic acid |
| SMILES | CC(C)(C)[C@@](CO)(Cc1ccccc1)NC(=O)O |
| InChI | InChI=1S/C14H21NO3/c1-13(2,3)14(10-16,15-12(17)18)9-11-7-5-4-6-8-11/h4-8,15-16H,9-10H2,1-3H3,(H,17,18)/t14-/m0/s1 |
| InChIKey | GXSQNDGJIALZBQ-AWEZNQCLSA-N |
| XLogP | 2.27 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |