C20H27ClF2N2O2 — CID 68902392
4-[3,5-difluoro-4-[(3-methylbutylamino)methyl]phenyl]-3-methylbenzamide;hydrate;hydrochloride (PubChem CID 68902392) has the molecular formula C20H27ClF2N2O2 and a molecular weight of 400.90 g/mol. Its IUPAC name is 4-[3,5-difluoro-4-[(3-methylbutylamino)methyl]phenyl]-3-methylbenzamide;hydrate;hydrochloride.
| Compound Name | 4-[3,5-difluoro-4-[(3-methylbutylamino)methyl]phenyl]-3-methylbenzamide;hydrate;hydrochloride |
|---|---|
| PubChem CID | 68902392 |
| Molecular Formula | C20H27ClF2N2O2 |
| Molecular Weight | 400.90 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 4-[3,5-difluoro-4-[(3-methylbutylamino)methyl]phenyl]-3-methylbenzamide;hydrate;hydrochloride |
| SMILES | Cc1cc(C(N)=O)ccc1-c1cc(F)c(CNCCC(C)C)c(F)c1.Cl.O |
| InChI | InChI=1S/C20H24F2N2O.ClH.H2O/c1-12(2)6-7-24-11-17-18(21)9-15(10-19(17)22)16-5-4-14(20(23)25)8-13(16)3;;/h4-5,8-10,12,24H,6-7,11H2,1-3H3,(H2,23,25);1H;1H2 |
| InChIKey | HWNQMENEYMNIOP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.90 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|