C19H22F2N2O — CID 24946250
4-fluoro-3-[2-fluoro-4-[(3-methylbutylamino)methyl]phenyl]benzamide (PubChem CID 24946250) has the molecular formula C19H22F2N2O and a molecular weight of 332.39 g/mol. Its IUPAC name is 4-fluoro-3-[2-fluoro-4-[(3-methylbutylamino)methyl]phenyl]benzamide.
| Compound Name | 4-fluoro-3-[2-fluoro-4-[(3-methylbutylamino)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 24946250 |
| Molecular Formula | C19H22F2N2O |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 4-fluoro-3-[2-fluoro-4-[(3-methylbutylamino)methyl]phenyl]benzamide |
| SMILES | CC(C)CCNCc1ccc(-c2cc(C(N)=O)ccc2F)c(F)c1 |
| InChI | InChI=1S/C19H22F2N2O/c1-12(2)7-8-23-11-13-3-5-15(18(21)9-13)16-10-14(19(22)24)4-6-17(16)20/h3-6,9-10,12,23H,7-8,11H2,1-2H3,(H2,22,24) |
| InChIKey | OVMZSYCGRALSHO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|