C20H22F2N4 — CID 24946594
N-[[3-fluoro-4-[2-fluoro-5-(1H-1,2,4-triazol-5-yl)phenyl]phenyl]methyl]-3-methylbutan-1-amine (PubChem CID 24946594) has the molecular formula C20H22F2N4 and a molecular weight of 356.42 g/mol. Its IUPAC name is N-[[3-fluoro-4-[2-fluoro-5-(1H-1,2,4-triazol-5-yl)phenyl]phenyl]methyl]-3-methylbutan-1-amine.
| Compound Name | N-[[3-fluoro-4-[2-fluoro-5-(1H-1,2,4-triazol-5-yl)phenyl]phenyl]methyl]-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 24946594 |
| Molecular Formula | C20H22F2N4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | N-[[3-fluoro-4-[2-fluoro-5-(1H-1,2,4-triazol-5-yl)phenyl]phenyl]methyl]-3-methylbutan-1-amine |
| SMILES | CC(C)CCNCc1ccc(-c2cc(-c3ncn[nH]3)ccc2F)c(F)c1 |
| InChI | InChI=1S/C20H22F2N4/c1-13(2)7-8-23-11-14-3-5-16(19(22)9-14)17-10-15(4-6-18(17)21)20-24-12-25-26-20/h3-6,9-10,12-13,23H,7-8,11H2,1-2H3,(H,24,25,26) |
| InChIKey | IMRLCQZYJXLODN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|