C19H16BrClF2N2O3S — CID 68902529
6-bromo-1-[1-(5-chloro-2,4-difluorophenyl)sulfinylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one (PubChem CID 68902529) has the molecular formula C19H16BrClF2N2O3S and a molecular weight of 505.77 g/mol. Its IUPAC name is 6-bromo-1-[1-(5-chloro-2,4-difluorophenyl)sulfinylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one.
| Compound Name | 6-bromo-1-[1-(5-chloro-2,4-difluorophenyl)sulfinylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 68902529 |
| Molecular Formula | C19H16BrClF2N2O3S |
| Molecular Weight | 505.77 g/mol |
| Exact Mass | 503.97 |
| IUPAC Name | 6-bromo-1-[1-(5-chloro-2,4-difluorophenyl)sulfinylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one |
| SMILES | O=C1OCc2cc(Br)ccc2N1C1CCN(S(=O)c2cc(Cl)c(F)cc2F)CC1 |
| InChI | InChI=1S/C19H16BrClF2N2O3S/c20-12-1-2-17-11(7-12)10-28-19(26)25(17)13-3-5-24(6-4-13)29(27)18-8-14(21)15(22)9-16(18)23/h1-2,7-9,13H,3-6,10H2 |
| InChIKey | CYAMKFTUEJBVJW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.77 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|