C30H31F3N2O2 — CID 68905957
N-tert-butyl-3-[[3-[4-(2-phenylethenyl)phenyl]-2-(trifluoromethyl)phenyl]methoxy]azetidine-1-carboxamide (PubChem CID 68905957) has the molecular formula C30H31F3N2O2 and a molecular weight of 508.58 g/mol. Its IUPAC name is N-tert-butyl-3-[[3-[4-(2-phenylethenyl)phenyl]-2-(trifluoromethyl)phenyl]methoxy]azetidine-1-carboxamide.
| Compound Name | N-tert-butyl-3-[[3-[4-(2-phenylethenyl)phenyl]-2-(trifluoromethyl)phenyl]methoxy]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 68905957 |
| Molecular Formula | C30H31F3N2O2 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | N-tert-butyl-3-[[3-[4-(2-phenylethenyl)phenyl]-2-(trifluoromethyl)phenyl]methoxy]azetidine-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1CC(OCc2cccc(-c3ccc(C=Cc4ccccc4)cc3)c2C(F)(F)F)C1 |
| InChI | InChI=1S/C30H31F3N2O2/c1-29(2,3)34-28(36)35-18-25(19-35)37-20-24-10-7-11-26(27(24)30(31,32)33)23-16-14-22(15-17-23)13-12-21-8-5-4-6-9-21/h4-17,25H,18-20H2,1-3H3,(H,34,36) |
| InChIKey | QVZHKXQHWGPSSU-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|