C28H29F3N2O2S — CID 87618201
N-tert-butyl-3-[[3-[4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)phenyl]-2-(trifluoromethyl)phenyl]methoxy]azetidine-1-carboxamide (PubChem CID 87618201) has the molecular formula C28H29F3N2O2S and a molecular weight of 514.61 g/mol. Its IUPAC name is N-tert-butyl-3-[[3-[4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)phenyl]-2-(trifluoromethyl)phenyl]methoxy]azetidine-1-carboxamide.
| Compound Name | N-tert-butyl-3-[[3-[4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)phenyl]-2-(trifluoromethyl)phenyl]methoxy]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 87618201 |
| Molecular Formula | C28H29F3N2O2S |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | N-tert-butyl-3-[[3-[4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)phenyl]-2-(trifluoromethyl)phenyl]methoxy]azetidine-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1CC(OCc2cccc(-c3ccc(C4=CC=CCC4=S)cc3)c2C(F)(F)F)C1 |
| InChI | InChI=1S/C28H29F3N2O2S/c1-27(2,3)32-26(34)33-15-21(16-33)35-17-20-7-6-9-23(25(20)28(29,30)31)19-13-11-18(12-14-19)22-8-4-5-10-24(22)36/h4-9,11-14,21H,10,15-17H2,1-3H3,(H,32,34) |
| InChIKey | STWFNGXMNXEGFD-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|