C21H24Cl2N2O2 — CID 11235177
N-tert-butyl-3-[(2-chlorophenyl)-(4-chlorophenyl)methoxy]azetidine-1-carboxamide (PubChem CID 11235177) has the molecular formula C21H24Cl2N2O2 and a molecular weight of 407.34 g/mol. Its IUPAC name is N-tert-butyl-3-[(2-chlorophenyl)-(4-chlorophenyl)methoxy]azetidine-1-carboxamide.
| Compound Name | N-tert-butyl-3-[(2-chlorophenyl)-(4-chlorophenyl)methoxy]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 11235177 |
| Molecular Formula | C21H24Cl2N2O2 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-tert-butyl-3-[(2-chlorophenyl)-(4-chlorophenyl)methoxy]azetidine-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1CC(OC(c2ccc(Cl)cc2)c2ccccc2Cl)C1 |
| InChI | InChI=1S/C21H24Cl2N2O2/c1-21(2,3)24-20(26)25-12-16(13-25)27-19(14-8-10-15(22)11-9-14)17-6-4-5-7-18(17)23/h4-11,16,19H,12-13H2,1-3H3,(H,24,26) |
| InChIKey | MLFSLFJODRKRDN-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |