C23H28Cl2N2O2 — CID 11235898
3-[(2-chlorophenyl)-(4-chlorophenyl)methoxy]-N-methyl-N-pentylazetidine-1-carboxamide (PubChem CID 11235898) has the molecular formula C23H28Cl2N2O2 and a molecular weight of 435.40 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)-(4-chlorophenyl)methoxy]-N-methyl-N-pentylazetidine-1-carboxamide.
| Compound Name | 3-[(2-chlorophenyl)-(4-chlorophenyl)methoxy]-N-methyl-N-pentylazetidine-1-carboxamide |
|---|---|
| PubChem CID | 11235898 |
| Molecular Formula | C23H28Cl2N2O2 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 3-[(2-chlorophenyl)-(4-chlorophenyl)methoxy]-N-methyl-N-pentylazetidine-1-carboxamide |
| SMILES | CCCCCN(C)C(=O)N1CC(OC(c2ccc(Cl)cc2)c2ccccc2Cl)C1 |
| InChI | InChI=1S/C23H28Cl2N2O2/c1-3-4-7-14-26(2)23(28)27-15-19(16-27)29-22(17-10-12-18(24)13-11-17)20-8-5-6-9-21(20)25/h5-6,8-13,19,22H,3-4,7,14-16H2,1-2H3 |
| InChIKey | MURFQOBLBDLEPH-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|