About 2-[(4-chlorophenyl)-phenylmethoxy]-N,N-dimethylethanamine;hydrochloride
2-[(4-chlorophenyl)-phenylmethoxy]-N,N-dimethylethanamine;hydrochloride (PubChem CID 2830868) has the molecular formula C17H21Cl2NO
and a molecular weight of 326.27 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)-phenylmethoxy]-N,N-dimethylethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-[(4-chlorophenyl)-phenylmethoxy]-N,N-dimethylethanamine;hydrochloride |
| PubChem CID | 2830868 |
| Molecular Formula | C17H21Cl2NO |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 2-[(4-chlorophenyl)-phenylmethoxy]-N,N-dimethylethanamine;hydrochloride |
| SMILES | CN(C)CCOC(c1ccccc1)c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C17H20ClNO.ClH/c1-19(2)12-13-20-17(14-6-4-3-5-7-14)15-8-10-16(18)11-9-15;/h3-11,17H,12-13H2,1-2H3;1H |
| InChIKey | SDTRPYDQWXMFOM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(4-chlorophenyl)-phenylmethoxy]-N,N-dimethylethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-chlorophenyl)-phenylmethoxy]-N,N-dimethylethanamine;hydrochloride?
The IUPAC name of 2-[(4-chlorophenyl)-phenylmethoxy]-N,N-dimethylethanamine;hydrochloride (CID 2830868) is 2-[(4-chlorophenyl)-phenylmethoxy]-N,N-dimethylethanamine;hydrochloride.
What is the SMILES notation for 2-[(4-chlorophenyl)-phenylmethoxy]-N,N-dimethylethanamine;hydrochloride?
The canonical SMILES for 2-[(4-chlorophenyl)-phenylmethoxy]-N,N-dimethylethanamine;hydrochloride is CN(C)CCOC(c1ccccc1)c1ccc(Cl)cc1.Cl.
What is the InChIKey of 2-[(4-chlorophenyl)-phenylmethoxy]-N,N-dimethylethanamine;hydrochloride?
The InChIKey is SDTRPYDQWXMFOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20ClNO.ClH/c1-19(2)12-13-20-17(14-6-4-3-5-7-14)15-8-10-16(18)11-9-15;/h3-11,17H,12-13H2,1-2H3;1H.
What are the key properties of 2-[(4-chlorophenyl)-phenylmethoxy]-N,N-dimethylethanamine;hydrochloride?
2-[(4-chlorophenyl)-phenylmethoxy]-N,N-dimethylethanamine;hydrochloride has a molecular weight of 326.27 g/mol, XLogP of 4.43, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-chlorophenyl)-phenylmethoxy]-N,N-dimethylethanamine;hydrochloride is sourced from PubChem (CID 2830868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).