C23H28Cl2N2O3 — CID 68947794
tert-butyl-[4-[(2-chlorophenyl)-(4-chlorophenyl)methoxy]piperidin-1-yl]carbamic acid (PubChem CID 68947794) has the molecular formula C23H28Cl2N2O3 and a molecular weight of 451.39 g/mol. Its IUPAC name is tert-butyl-[4-[(2-chlorophenyl)-(4-chlorophenyl)methoxy]piperidin-1-yl]carbamic acid.
| Compound Name | tert-butyl-[4-[(2-chlorophenyl)-(4-chlorophenyl)methoxy]piperidin-1-yl]carbamic acid |
|---|---|
| PubChem CID | 68947794 |
| Molecular Formula | C23H28Cl2N2O3 |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | tert-butyl-[4-[(2-chlorophenyl)-(4-chlorophenyl)methoxy]piperidin-1-yl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)N1CCC(OC(c2ccc(Cl)cc2)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C23H28Cl2N2O3/c1-23(2,3)27(22(28)29)26-14-12-18(13-15-26)30-21(16-8-10-17(24)11-9-16)19-6-4-5-7-20(19)25/h4-11,18,21H,12-15H2,1-3H3,(H,28,29) |
| InChIKey | QHHRZKCYMFZXTP-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |