C23H20Cl2N2O4S — CID 68942165
N-(benzenesulfonyl)-3-[(2-chlorophenyl)-(4-chlorophenyl)methoxy]azetidine-1-carboxamide (PubChem CID 68942165) has the molecular formula C23H20Cl2N2O4S and a molecular weight of 491.40 g/mol. Its IUPAC name is N-(benzenesulfonyl)-3-[(2-chlorophenyl)-(4-chlorophenyl)methoxy]azetidine-1-carboxamide.
| Compound Name | N-(benzenesulfonyl)-3-[(2-chlorophenyl)-(4-chlorophenyl)methoxy]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 68942165 |
| Molecular Formula | C23H20Cl2N2O4S |
| Molecular Weight | 491.40 g/mol |
| Exact Mass | 490.05 |
| IUPAC Name | N-(benzenesulfonyl)-3-[(2-chlorophenyl)-(4-chlorophenyl)methoxy]azetidine-1-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1ccccc1)N1CC(OC(c2ccc(Cl)cc2)c2ccccc2Cl)C1 |
| InChI | InChI=1S/C23H20Cl2N2O4S/c24-17-12-10-16(11-13-17)22(20-8-4-5-9-21(20)25)31-18-14-27(15-18)23(28)26-32(29,30)19-6-2-1-3-7-19/h1-13,18,22H,14-15H2,(H,26,28) |
| InChIKey | RJNCRFHOPDVMMW-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |