C24H26Cl2N2O2 — CID 68904220
N-(1-bicyclo[2.2.1]heptanyl)-3-[bis(4-chlorophenyl)methoxy]azetidine-1-carboxamide (PubChem CID 68904220) has the molecular formula C24H26Cl2N2O2 and a molecular weight of 445.39 g/mol. Its IUPAC name is N-(1-bicyclo[2.2.1]heptanyl)-3-[bis(4-chlorophenyl)methoxy]azetidine-1-carboxamide.
| Compound Name | N-(1-bicyclo[2.2.1]heptanyl)-3-[bis(4-chlorophenyl)methoxy]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 68904220 |
| Molecular Formula | C24H26Cl2N2O2 |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | N-(1-bicyclo[2.2.1]heptanyl)-3-[bis(4-chlorophenyl)methoxy]azetidine-1-carboxamide |
| SMILES | O=C(NC12CCC(CC1)C2)N1CC(OC(c2ccc(Cl)cc2)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C24H26Cl2N2O2/c25-19-5-1-17(2-6-19)22(18-3-7-20(26)8-4-18)30-21-14-28(15-21)23(29)27-24-11-9-16(13-24)10-12-24/h1-8,16,21-22H,9-15H2,(H,27,29) |
| InChIKey | XPTWIGBCHGWRCY-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |