C21H21Cl2F2N3O2 — CID 57401755
[3-[(4-chlorophenyl)-(2-chloro-3-pyridinyl)methoxy]azetidin-1-yl]-(4,4-difluoropiperidin-1-yl)methanone (PubChem CID 57401755) has the molecular formula C21H21Cl2F2N3O2 and a molecular weight of 456.32 g/mol. Its IUPAC name is [3-[(4-chlorophenyl)-(2-chloro-3-pyridinyl)methoxy]azetidin-1-yl]-(4,4-difluoropiperidin-1-yl)methanone.
| Compound Name | [3-[(4-chlorophenyl)-(2-chloro-3-pyridinyl)methoxy]azetidin-1-yl]-(4,4-difluoropiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 57401755 |
| Molecular Formula | C21H21Cl2F2N3O2 |
| Molecular Weight | 456.32 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | [3-[(4-chlorophenyl)-(2-chloro-3-pyridinyl)methoxy]azetidin-1-yl]-(4,4-difluoropiperidin-1-yl)methanone |
| SMILES | O=C(N1CCC(F)(F)CC1)N1CC(OC(c2ccc(Cl)cc2)c2cccnc2Cl)C1 |
| InChI | InChI=1S/C21H21Cl2F2N3O2/c22-15-5-3-14(4-6-15)18(17-2-1-9-26-19(17)23)30-16-12-28(13-16)20(29)27-10-7-21(24,25)8-11-27/h1-6,9,16,18H,7-8,10-13H2 |
| InChIKey | SHHXUIXPXHEWHL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.32 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|