C17H18Cl2N2O — CID 102045851
2-chloro-3-[(4-chlorophenyl)-[(3R)-piperidin-3-yl]oxymethyl]pyridine (PubChem CID 102045851) has the molecular formula C17H18Cl2N2O and a molecular weight of 337.25 g/mol. Its IUPAC name is 2-chloro-3-[(4-chlorophenyl)-[(3R)-piperidin-3-yl]oxymethyl]pyridine.
| Compound Name | 2-chloro-3-[(4-chlorophenyl)-[(3R)-piperidin-3-yl]oxymethyl]pyridine |
|---|---|
| PubChem CID | 102045851 |
| Molecular Formula | C17H18Cl2N2O |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2-chloro-3-[(4-chlorophenyl)-[(3R)-piperidin-3-yl]oxymethyl]pyridine |
| SMILES | Clc1ccc(C(O[C@@H]2CCCNC2)c2cccnc2Cl)cc1 |
| InChI | InChI=1S/C17H18Cl2N2O/c18-13-7-5-12(6-8-13)16(15-4-2-10-21-17(15)19)22-14-3-1-9-20-11-14/h2,4-8,10,14,16,20H,1,3,9,11H2/t14-,16?/m1/s1 |
| InChIKey | QJZGTNYWTDYMST-IURRXHLWSA-N |
| XLogP | 4.25 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|