C26H28Cl2N2O2 — CID 167069098
3-[bis(2-chlorophenyl)methoxy]-N-(3-methyl-1-bicyclo[3.2.1]oct-5-enyl)azetidine-1-carboxamide (PubChem CID 167069098) has the molecular formula C26H28Cl2N2O2 and a molecular weight of 471.43 g/mol. Its IUPAC name is 3-[bis(2-chlorophenyl)methoxy]-N-(3-methyl-1-bicyclo[3.2.1]oct-5-enyl)azetidine-1-carboxamide.
| Compound Name | 3-[bis(2-chlorophenyl)methoxy]-N-(3-methyl-1-bicyclo[3.2.1]oct-5-enyl)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 167069098 |
| Molecular Formula | C26H28Cl2N2O2 |
| Molecular Weight | 471.43 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 3-[bis(2-chlorophenyl)methoxy]-N-(3-methyl-1-bicyclo[3.2.1]oct-5-enyl)azetidine-1-carboxamide |
| SMILES | CC1CC2=CCC(NC(=O)N3CC(OC(c4ccccc4Cl)c4ccccc4Cl)C3)(C2)C1 |
| InChI | InChI=1S/C26H28Cl2N2O2/c1-17-12-18-10-11-26(13-17,14-18)29-25(31)30-15-19(16-30)32-24(20-6-2-4-8-22(20)27)21-7-3-5-9-23(21)28/h2-10,17,19,24H,11-16H2,1H3,(H,29,31) |
| InChIKey | DUUQXINHVDKZFZ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.43 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|