C23H26ClF3N2O2 — CID 87630410
N-tert-butyl-N-[(R)-(4-chlorophenyl)-[2-(trifluoromethyl)phenyl]methoxy]pyrrolidine-1-carboxamide (PubChem CID 87630410) has the molecular formula C23H26ClF3N2O2 and a molecular weight of 454.92 g/mol. Its IUPAC name is N-tert-butyl-N-[(R)-(4-chlorophenyl)-[2-(trifluoromethyl)phenyl]methoxy]pyrrolidine-1-carboxamide.
| Compound Name | N-tert-butyl-N-[(R)-(4-chlorophenyl)-[2-(trifluoromethyl)phenyl]methoxy]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 87630410 |
| Molecular Formula | C23H26ClF3N2O2 |
| Molecular Weight | 454.92 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | N-tert-butyl-N-[(R)-(4-chlorophenyl)-[2-(trifluoromethyl)phenyl]methoxy]pyrrolidine-1-carboxamide |
| SMILES | CC(C)(C)N(O[C@H](c1ccc(Cl)cc1)c1ccccc1C(F)(F)F)C(=O)N1CCCC1 |
| InChI | InChI=1S/C23H26ClF3N2O2/c1-22(2,3)29(21(30)28-14-6-7-15-28)31-20(16-10-12-17(24)13-11-16)18-8-4-5-9-19(18)23(25,26)27/h4-5,8-13,20H,6-7,14-15H2,1-3H3/t20-/m1/s1 |
| InChIKey | LWQNMTCSIYTJBO-HXUWFJFHSA-N |
| XLogP | 6.70 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.92 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|