C26H31ClN6O3S — CID 68907633
5-(2-acetamidoethyl)-N-[(1S,2R)-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclohexyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 68907633) has the molecular formula C26H31ClN6O3S and a molecular weight of 543.09 g/mol. Its IUPAC name is 5-(2-acetamidoethyl)-N-[(1S,2R)-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclohexyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | 5-(2-acetamidoethyl)-N-[(1S,2R)-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclohexyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 68907633 |
| Molecular Formula | C26H31ClN6O3S |
| Molecular Weight | 543.09 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | 5-(2-acetamidoethyl)-N-[(1S,2R)-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclohexyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | CC(=O)NCCN1CCc2nc(C(=O)N[C@H]3CCCC[C@H]3NC(=O)c3cc4cc(Cl)ccc4[nH]3)sc2C1 |
| InChI | InChI=1S/C26H31ClN6O3S/c1-15(34)28-9-11-33-10-8-21-23(14-33)37-26(32-21)25(36)31-20-5-3-2-4-19(20)30-24(35)22-13-16-12-17(27)6-7-18(16)29-22/h6-7,12-13,19-20,29H,2-5,8-11,14H2,1H3,(H,28,34)(H,30,35)(H,31,36)/t19-,20+/m1/s1 |
| InChIKey | BCTLOAJNZVOYEP-UXHICEINSA-N |
| XLogP | 3.24 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.09 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |