C25H31ClN6O4S2 — CID 68909335
N-[(1S,2R)-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclohexyl]-5-[2-(methanesulfonamido)ethyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 68909335) has the molecular formula C25H31ClN6O4S2 and a molecular weight of 579.15 g/mol. Its IUPAC name is N-[(1S,2R)-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclohexyl]-5-[2-(methanesulfonamido)ethyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | N-[(1S,2R)-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclohexyl]-5-[2-(methanesulfonamido)ethyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 68909335 |
| Molecular Formula | C25H31ClN6O4S2 |
| Molecular Weight | 579.15 g/mol |
| Exact Mass | 578.15 |
| IUPAC Name | N-[(1S,2R)-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclohexyl]-5-[2-(methanesulfonamido)ethyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | CS(=O)(=O)NCCN1CCc2nc(C(=O)N[C@H]3CCCC[C@H]3NC(=O)c3cc4cc(Cl)ccc4[nH]3)sc2C1 |
| InChI | InChI=1S/C25H31ClN6O4S2/c1-38(35,36)27-9-11-32-10-8-20-22(14-32)37-25(31-20)24(34)30-19-5-3-2-4-18(19)29-23(33)21-13-15-12-16(26)6-7-17(15)28-21/h6-7,12-13,18-19,27-28H,2-5,8-11,14H2,1H3,(H,29,33)(H,30,34)/t18-,19+/m1/s1 |
| InChIKey | ZMDCTAQCOSJTDD-MOPGFXCFSA-N |
| XLogP | 2.66 |
| TPSA | 136.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.15 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |