C16H23N3O4 — CID 68909215
(2R)-4-[(1R)-2-(methoxymethylamino)-2-oxo-1-phenylethyl]-2-methylpiperazine-1-carboxylic acid (PubChem CID 68909215) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is (2R)-4-[(1R)-2-(methoxymethylamino)-2-oxo-1-phenylethyl]-2-methylpiperazine-1-carboxylic acid.
| Compound Name | (2R)-4-[(1R)-2-(methoxymethylamino)-2-oxo-1-phenylethyl]-2-methylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 68909215 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (2R)-4-[(1R)-2-(methoxymethylamino)-2-oxo-1-phenylethyl]-2-methylpiperazine-1-carboxylic acid |
| SMILES | COCNC(=O)[C@@H](c1ccccc1)N1CCN(C(=O)O)[C@H](C)C1 |
| InChI | InChI=1S/C16H23N3O4/c1-12-10-18(8-9-19(12)16(21)22)14(15(20)17-11-23-2)13-6-4-3-5-7-13/h3-7,12,14H,8-11H2,1-2H3,(H,17,20)(H,21,22)/t12-,14-/m1/s1 |
| InChIKey | QDZDYXBBNFBIBL-TZMCWYRMSA-N |
| XLogP | 1.13 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|