C21H21Cl2F2N3O2 — CID 68910067
ethyl 1-[[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]methyl]-5-methylpyrazole-3-carboximidate;hydrochloride (PubChem CID 68910067) has the molecular formula C21H21Cl2F2N3O2 and a molecular weight of 456.32 g/mol. Its IUPAC name is ethyl 1-[[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]methyl]-5-methylpyrazole-3-carboximidate;hydrochloride.
| Compound Name | ethyl 1-[[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]methyl]-5-methylpyrazole-3-carboximidate;hydrochloride |
|---|---|
| PubChem CID | 68910067 |
| Molecular Formula | C21H21Cl2F2N3O2 |
| Molecular Weight | 456.32 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | ethyl 1-[[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]methyl]-5-methylpyrazole-3-carboximidate;hydrochloride |
| SMILES | Cl.[H]/N=C(\OCC)c1cc(C)n(Cc2cc(Cl)ccc2OCc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C21H20ClF2N3O2.ClH/c1-3-28-21(25)19-8-13(2)27(26-19)11-15-9-16(22)5-7-20(15)29-12-14-4-6-17(23)10-18(14)24;/h4-10,25H,3,11-12H2,1-2H3;1H/b25-21-; |
| InChIKey | ISNXXOVJJYGMLF-NBFRYIKDSA-N |
| XLogP | 5.53 |
| TPSA | 60.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.32 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|