C7H10N8 — CID 6891021
1-[(E)-(1,3-dimethylpyrazol-4-yl)methylideneamino]tetrazol-5-amine (PubChem CID 6891021) has the molecular formula C7H10N8 and a molecular weight of 206.21 g/mol. Its IUPAC name is 1-[(E)-(1,3-dimethylpyrazol-4-yl)methylideneamino]tetrazol-5-amine.
| Compound Name | 1-[(E)-(1,3-dimethylpyrazol-4-yl)methylideneamino]tetrazol-5-amine |
|---|---|
| PubChem CID | 6891021 |
| Molecular Formula | C7H10N8 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 1-[(E)-(1,3-dimethylpyrazol-4-yl)methylideneamino]tetrazol-5-amine |
| SMILES | Cc1nn(C)cc1/C=N/n1nnnc1N |
| InChI | InChI=1S/C7H10N8/c1-5-6(4-14(2)11-5)3-9-15-7(8)10-12-13-15/h3-4H,1-2H3,(H2,8,10,13)/b9-3+ |
| InChIKey | GARPYAXHSOTQLG-YCRREMRBSA-N |
| XLogP | -0.82 |
| TPSA | 99.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|