C12H16N8 — CID 75406485
3,6-bis(3,4-dimethylpyrazol-1-yl)-1,4-dihydro-1,2,4,5-tetrazine (PubChem CID 75406485) has the molecular formula C12H16N8 and a molecular weight of 272.32 g/mol. Its IUPAC name is 3,6-bis(3,4-dimethylpyrazol-1-yl)-1,4-dihydro-1,2,4,5-tetrazine.
| Compound Name | 3,6-bis(3,4-dimethylpyrazol-1-yl)-1,4-dihydro-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 75406485 |
| Molecular Formula | C12H16N8 |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 3,6-bis(3,4-dimethylpyrazol-1-yl)-1,4-dihydro-1,2,4,5-tetrazine |
| SMILES | Cc1cn(C2=NNC(n3cc(C)c(C)n3)=NN2)nc1C |
| InChI | InChI=1S/C12H16N8/c1-7-5-19(17-9(7)3)11-13-15-12(16-14-11)20-6-8(2)10(4)18-20/h5-6H,1-4H3,(H,13,14)(H,15,16) |
| InChIKey | PFHUXFBGCGLXLO-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |