C29H36N2O2 — CID 68912107
6-[(3S,4S)-3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-4-phenylpyrrolidin-1-yl]hexanoic acid (PubChem CID 68912107) has the molecular formula C29H36N2O2 and a molecular weight of 444.62 g/mol. Its IUPAC name is 6-[(3S,4S)-3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-4-phenylpyrrolidin-1-yl]hexanoic acid.
| Compound Name | 6-[(3S,4S)-3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-4-phenylpyrrolidin-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 68912107 |
| Molecular Formula | C29H36N2O2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | 6-[(3S,4S)-3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-4-phenylpyrrolidin-1-yl]hexanoic acid |
| SMILES | C[C@@H](NC[C@H]1CN(CCCCCC(=O)O)C[C@@H]1c1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C29H36N2O2/c1-22(26-16-10-14-23-13-7-8-15-27(23)26)30-19-25-20-31(18-9-3-6-17-29(32)33)21-28(25)24-11-4-2-5-12-24/h2,4-5,7-8,10-16,22,25,28,30H,3,6,9,17-21H2,1H3,(H,32,33)/t22-,25+,28-/m1/s1 |
| InChIKey | YZOANZOVFXNFKQ-MDQGVCTMSA-N |
| XLogP | 5.85 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|