C32H40N2O3 — CID 68914376
ethyl 7-[(3R,4S)-3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-4-phenylpyrrolidin-1-yl]-7-oxoheptanoate (PubChem CID 68914376) has the molecular formula C32H40N2O3 and a molecular weight of 500.68 g/mol. Its IUPAC name is ethyl 7-[(3R,4S)-3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-4-phenylpyrrolidin-1-yl]-7-oxoheptanoate.
| Compound Name | ethyl 7-[(3R,4S)-3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-4-phenylpyrrolidin-1-yl]-7-oxoheptanoate |
|---|---|
| PubChem CID | 68914376 |
| Molecular Formula | C32H40N2O3 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | ethyl 7-[(3R,4S)-3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-4-phenylpyrrolidin-1-yl]-7-oxoheptanoate |
| SMILES | CCOC(=O)CCCCCC(=O)N1C[C@@H](CN[C@H](C)c2cccc3ccccc23)[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C32H40N2O3/c1-3-37-32(36)20-9-5-8-19-31(35)34-22-27(30(23-34)26-13-6-4-7-14-26)21-33-24(2)28-18-12-16-25-15-10-11-17-29(25)28/h4,6-7,10-18,24,27,30,33H,3,5,8-9,19-23H2,1-2H3/t24-,27-,30-/m1/s1 |
| InChIKey | PNBIAZATJIEMFQ-UCVANPEUSA-N |
| XLogP | 6.25 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|