C25H34N2O2S — CID 68912534
4-propan-2-yl-N-(1-propyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-7-yl)benzenesulfonamide (PubChem CID 68912534) has the molecular formula C25H34N2O2S and a molecular weight of 426.63 g/mol. Its IUPAC name is 4-propan-2-yl-N-(1-propyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-7-yl)benzenesulfonamide.
| Compound Name | 4-propan-2-yl-N-(1-propyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-7-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 68912534 |
| Molecular Formula | C25H34N2O2S |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 4-propan-2-yl-N-(1-propyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-7-yl)benzenesulfonamide |
| SMILES | CCCN1CCCC2Cc3cc(NS(=O)(=O)c4ccc(C(C)C)cc4)ccc3CC21 |
| InChI | InChI=1S/C25H34N2O2S/c1-4-13-27-14-5-6-21-15-22-16-23(10-7-20(22)17-25(21)27)26-30(28,29)24-11-8-19(9-12-24)18(2)3/h7-12,16,18,21,25-26H,4-6,13-15,17H2,1-3H3 |
| InChIKey | SZTZRCAOXISPOE-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |