C23H25F3N2O3S — CID 68914587
N-[(4aS,10aS)-1-propanoyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-8-yl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 68914587) has the molecular formula C23H25F3N2O3S and a molecular weight of 466.53 g/mol. Its IUPAC name is N-[(4aS,10aS)-1-propanoyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-8-yl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[(4aS,10aS)-1-propanoyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-8-yl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 68914587 |
| Molecular Formula | C23H25F3N2O3S |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | N-[(4aS,10aS)-1-propanoyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-8-yl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCC(=O)N1CCC[C@H]2Cc3ccc(NS(=O)(=O)c4ccc(C(F)(F)F)cc4)cc3C[C@@H]21 |
| InChI | InChI=1S/C23H25F3N2O3S/c1-2-22(29)28-11-3-4-16-12-15-5-8-19(13-17(15)14-21(16)28)27-32(30,31)20-9-6-18(7-10-20)23(24,25)26/h5-10,13,16,21,27H,2-4,11-12,14H2,1H3/t16-,21-/m0/s1 |
| InChIKey | HHDWCESOBRVDGD-KKSFZXQISA-N |
| XLogP | 4.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |