C25H21NO5S — CID 68912569
4-[4-(2-carboxyethenyl)phenyl]-2-(4-propan-2-yloxyphenyl)thieno[3,2-b]pyrrole-5-carboxylic acid (PubChem CID 68912569) has the molecular formula C25H21NO5S and a molecular weight of 447.51 g/mol. Its IUPAC name is 4-[4-(2-carboxyethenyl)phenyl]-2-(4-propan-2-yloxyphenyl)thieno[3,2-b]pyrrole-5-carboxylic acid.
| Compound Name | 4-[4-(2-carboxyethenyl)phenyl]-2-(4-propan-2-yloxyphenyl)thieno[3,2-b]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 68912569 |
| Molecular Formula | C25H21NO5S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 4-[4-(2-carboxyethenyl)phenyl]-2-(4-propan-2-yloxyphenyl)thieno[3,2-b]pyrrole-5-carboxylic acid |
| SMILES | CC(C)Oc1ccc(-c2cc3c(cc(C(=O)O)n3-c3ccc(C=CC(=O)O)cc3)s2)cc1 |
| InChI | InChI=1S/C25H21NO5S/c1-15(2)31-19-10-6-17(7-11-19)22-13-20-23(32-22)14-21(25(29)30)26(20)18-8-3-16(4-9-18)5-12-24(27)28/h3-15H,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | BTWFRFGCRZEABC-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|